Histidin: Razlika između izmjena

Dodano 79 bajtova ,  prije 8 godina
m
+
m (+)
m (+)
| SMILES = N[C@@H](Cc1[nH]cnc1)C(O)=O
| InChI =
| StdInChI = 1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m0/s1
| StdInChI =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey =
12.945.688

izmjena