Razlike između izmjena na stranici "Saharoza"

Dodano 13 bajtova ,  prije 8 godina
m
+
m (+)
m (+)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| Beilstein =
| Gmelin =
| StdInChIKey = CZMRCDWAGMRECN-UGDNZRGBSA-N
| SMILES = O1[C@H](CO)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[C@@]2(O[C@@H]([C@@H](O)[C@@H]2O)CO)CO
12.945.688

izmjena