Razlike između izmjena na stranici "Guanin"

Dodano 1.540 bajtova ,  prije 7 godina
nema sažetka uređivanja
m (Bot: popravljanje preusmjeravanja)
{{Chembox-lat
{| {{prettyinfobox}}
| Watchedfields =
! colspan="2" align=center bgcolor="#cccccc" | '''Guanin'''
| verifiedrevid = 443850318
|-
| ImageFile1 = Guanin.svg
| [[AJUPAK nomenklatura|Hemijsko ime]]
| ImageSize1 = 150px
| 2-Amino-1''H''-purin-6(9''H'')-jedan
| ImageFileL2 = Guanine-3D-balls.png
|-
| ImageFileR2 = Guanine-3D-vdW.png
|Alternativno ime
| ImageSizeL2 = 120px
|2-amino-6-okso-purin
| ImageSizeR2 = 120px
|-
| IUPACName = 2-Aminoamino-1''H''-purin-6(9''H'')-jedanon
| [[Kemijska formula|Hemijska formula]]
| OtherNames = 2-amino-6-hidroksipurin,<br />2-aminohipoksantin,<br />Guanin
| C<sub>5</sub>H<sub>5</sub>N<sub>5</sub>O
| Section1 = {{Chembox Identifiers-lat
|-
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| [[Molekulska masa]]
| DrugBank = DB02377
| 151,13 g/mol
| ChEBI_Ref = {{ebicite|correct|EBI}}
|-
| ChEBI = 16235
| [[talište|tačka topljenja]]
| SMILES = c1[nH]c2c(n1)c(=O)[nH]c(n2)N
| 360&nbsp;°C
| UNII_Ref = {{fdacite|correct|FDA}}
|-
| UNII = 5Z93L87A1R
| [[CAS registarski broj|CAS broj]]
| KEGG_Ref = {{keggcite|correct|kegg}}
| 73-40-5
| KEGG = C00242
|-
| InChI = 1/C5H5N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11)
| [[SMILES]]
| InChIKey = UYTPUPDQBNUYGX-UHFFFAOYAE
| NC(NC1=O)=NC2=C1N=CN2
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
|-
| ChemSpiderID = 744
| colspan="2" align="center" | [[Datoteka:Guanine_chemical_structure.png|172px|Hemijska struktura guanina]]
| ChEMBL_Ref = {{ebicite|correct|EBI}}
|-
| ChEMBL = 219568
|}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
 
| StdInChI = 1S/C5H5N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UYTPUPDQBNUYGX-UHFFFAOYSA-N
| CASNo = 73-40-5
| CASNo_Ref = {{cascite|correct|CAS}}
| RTECS = MF8260000
|}}
| Section2 = {{Chembox Properties-lat
| Formula = C<sub>5</sub>H<sub>5</sub>N<sub>5</sub>O
| MolarMass = 151,13 g/mol
| Appearance = Bela amorfna čvrsta materija
| Density = 2,200 g/cm<sup>3</sup> (izračunata)
| Solubility = nerastvoran.
| MeltingPt = 360&nbsp;°C (633.15 K) ''razlaže se''
| BoilingPt = sublimira
| pKa=3,3 (amid), 9,2 (sekondarna), 12,3 (primarna)<ref>Dawson, R.M.C., et al., ''Data for Biochemical Research'', Oxford, Clarendon Press, 1959.</ref>
| Dipole =
}}
| Section7 = {{Chembox Hazards-lat
| MainHazards = Iritant
| NFPA-H = 1
| NFPA-F = 1
| NFPA-R =
| FlashPt = nije zapaljiv
}}| Section8 = {{Chembox Related-lat
| OtherAnions =
| OtherCations =
| OtherCpds = [[Citozin]]; [[Adenin]]; [[Timin]]; [[Uracil]]
}}
}}
'''Guanin''' je jedna od četiri glavne [[nukleobaza|nukleobaze]] koje se nalaze u [[nukleinska kiselina|nukleinskim kiselinama]] ([[DNK]] i [[Ribonukleinska kiselina|RNK]]). Guanin je derivat [[purin]]a, a u [[bazni par|baznom paru]] pravi tri [[vodonična veza|vodonične veze]] sa [[citozin]]om. Guanin se "gomila" vertikalno sa ostalim nukleobazama pomoću aromatskih interakcija. Guanin je tautomer (vidi [[keto-enol tautomerizam]]). [[Nukleozid]] guanina je [[guanozin]].
 
Guanin je takođe ime bele amorfne supstance koja se nalazi u krljuštima određenih riba, izmetu određenih ptica i [[jetra|jetri]] i [[pankreas]]u [[sisavac|sisara]]. U stvari, ime nukleinske baze je izvedeno iz termina 'guano' (ptičiji izmet), jer je guanin prvi put izolovan iz ptičijeg izmeta.
 
== Eksterni linkoviReference ==
{{reflist|2}}
 
== Vanjske veze ==
{{Portal|Hemija}}
{{Commonscat|Guanine}}
* [http://www.compchemwiki.org/index.php?title=Guanine Computational Chemistry Wiki]
{{-}}
{{Nukleobaze, nukleozidi, i nukleotidi}}
 
[[Kategorija:Purini]]
[[Kategorija:Nukleobaze]]
1.513.357

izmjena