Razlike između izmjena na stranici "Koenzim A"

Dodan 1.881 bajt ,  prije 5 godina
nema sažetka uređivanja
(n/č sa hr.viki)
[[Datoteka:Coenzym A.svg|mini|350px|Strukturna formula koenzima A.]]
| Verifiedfields =
[[Datoteka:Coenzyme-A-3D-balls.png|mini|350px|3D prikaz molekule koenzima A.]]
| verifiedrevid = 400824515
| ImageFile = Coenzym A.svg
| ImageSize = 350px
| ImageFile2 = Coenzyme-A-3D-balls.png
| ImageSize2 = 350px
| IUPACName =
| OtherNames =
| Section1 = {{Chembox Identifiers-lat
| Abbreviations =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 6557
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1213327
| UNII_Ref = {{fdacite|correct|FDA}}
| InChI = 1/C21H36N7O16P3S/c1-21(2,16(31)19(32)24-4-3-12(29)23-5-6-48)8-41-47(38,39)44-46(36,37)40-7-11-15(43-45(33,34)35)14(30)20(42-11)28-10-27-13-17(22)25-9-26-18(13)28/h9-11,14-16,20,30-31,48H,3-8H2,1-2H3,(H,23,29)(H,24,32)(H,36,37)(H,38,39)(H2,22,25,26)(H2,33,34,35)/t11-,14-,15-,16?,20-/m1/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H36N7O16P3S/c1-21(2,16(31)19(32)24-4-3-12(29)23-5-6-48)8-41-47(38,39)44-46(36,37)40-7-11-15(43-45(33,34)35)14(30)20(42-11)28-10-27-13-17(22)25-9-26-18(13)28/h9-11,14-16,20,30-31,48H,3-8H2,1-2H3,(H,23,29)(H,24,32)(H,36,37)(H,38,39)(H2,22,25,26)(H2,33,34,35)/t11-,14-,15-,16?,20-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 85-61-0
| PubChem = 6816
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01992
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C00010
| SMILES = O=C(NCCS)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n2cnc1c(ncnc12)N)[C@H](O)[C@@H]3OP(=O)(O)O
| MeSHName = Coenzyme+A
| Section2 = {{Chembox Properties-lat
| Formula = C<sub>21</sub>H<sub>36</sub>N<sub>7</sub>O<sub>16</sub>P<sub>3</sub>S
| MolarMass = 767.535
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Section3 = {{Chembox Hazards-lat
| Solubility =
| MainHazards =
| FlashPt =
| Autoignition =
'''Koenzim A''' (skraćeno: '''CoA''', '''CoASH''', '''HSCoA''') je jedna od temeljnih molekula u metabolizmu. Ovaj koenzim nastaje sintezom [[ATP]], [[Vitamin B5|pantotenske kiseline]] i [[cisteamin]]a i ulazi u ključne metaboličke puteve, kao oksidacija masnih kiselina ([[Beta oksidacija|β-oksidacija]]) i [[Krebsov ciklus]]. Oko 4% svih enzimskih reakcija koristi ovu molekulu kao koenzim<ref>{{cite journal |title=Complete Reconstitution of the Human Coenzyme A Biosynthetic Pathway via Comparative Genomics |author=Matthew Daugherty, Boris Polanuyer, Michael Farrell, Michael Scholle, Athanasios Lykidis, Valérie de Crécy-Lagard and Andrei Osterman |year=2002. |doi=10.1074/jbc.M201708200 |journal=The Journal of Biological Chemistry |volume=277 |pages=21431–21439 |pmid=11923312}}</ref>. Njegova je uloga prijenos acilnih skupina u obliku visokoenergetskih [[tioester]]a. U većini slučajeva koenzim A prenosi acetilnu skupinu i tada se naziva [[acetil koenzim A]] (Acetil-CoA). Slobodan koenzim A, koji ne prenosi nikakvu acilnu skupinu označava se s CoASH, kako bi se ukazalo na činjenicu da je -SH skupina slobodna za daljnje reakcije.
== Spoljašnje veze ==
{{Commonscat|Coenzyme A}}
