Glukoza – razlika između verzija
Uklonjeni sadržaj Dodani sadržaj
m Bot: Migrating 78 interwiki links, now provided by Wikidata on d:q37525 (translate me) |
dodan chembox |
||
Red 1:
{{chembox
[[Datoteka:DL-Glucose.svg|thumb|right|200px|Strukturna formula]]▼
| Watchedfields = changed
'''Glukoza''' je najrasprostranjeniji [[monosaharid]] u [[priroda|prirodi]], međutim samo kao [[izomer]] koji se zove dekstroza ili grožđani šećer. Može da se nađe u [[krv]]i svih [[sisari|sisara]] kao i u [[med]]u i [[grožđe|grožđu]].▼
| verifiedrevid = 311440464
| Name = <small>D</small>-Glukoza
| ImageFileL1 = Glucose structure.svg
| ImageStyleL1 = padding 30px 5px 5px 6px
| ImageSizeL1 = 120px
| ImageFileR1 = DGlucose Fischer.svg
| ImageSizeR1 = 60px
| ImageFile2 = Glucose chain structure.svg
| ImageSize2 = 200px
| ImageFile3 = D-glucose-chain-3D-balls.png
| ImageSize3 = 240px
| IUPACName = 6-(hydroxymethyl)oxane-2,3,4,5-tetrol
| OtherNames = Dekstroza, grožđani šećer, krvni šećer, kukuruzni šećer
| Section1 = {{Chembox Identifiers
| Abbreviations = '''Glc'''
| CASNo = 50-99-7
| CASNo_Ref = {{cascite}}
| CASOther = <br/>492-62-6 (α-anomer)<br/>492-61-5 (β-anomer) <!-- these CAS numbers have been verified against CAS Common Chemistry -->
| EINECS = 200-075-1
| PubChem = 5793
| ChemSpiderID = 5589
| HMDB = HMDB00122
| SMILES = OC[C@@H](O1)[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)1 (glukopiranoza) ;
OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O (aciklična glukoza).
| MeSHName =Glucose
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>6</sub>H<sub>12</sub>O<sub>6</sub>
| MolarMass = 180.16 g/mol <ref name="CRC">{{RubberBible87th}}</ref>
| ExactMass = 180.063388
| MeltingPt = α-<small>D</small>-glukoza: 146 °C<br />β-<small>D</small>-glukoza: 150 °C <ref name="CRC" />
| Density = 1.54 g/cm<sup>3</sup>
| Solubility = 91 g/100 ml (25 °C) <ref>{{citation | url = http://oru.edu/cccda/sl/solubility/allsolvents.php?solute=D-glucose | title = Solubility of D-glucose in non-aqueous solvents}}.</ref>
| Solubility1 = 0.037 M
| Solvent1 = metanol
| Solubility2 = 0.006 M
| Solvent2 = etanol
| Solubility3 = 0.016 M
| Solvent3 = tetrahidrofuran
}}
| Section3 = {{Chembox Thermochemistry
| Reference = <ref>{{citation | last1 = Ponomarev | first1 = V. V. | last2 = Migarskaya | first2 = L. B. | title = Heats of combustion of some amino-acids | journal = Russ. J. Phys. Chem. (Engl. Transl.) | year = 1960 | volume = 34 | pages = 1182–83}}. {{citation | last = Boerio-Goates | first = Juliana | title = Heat-capacity measurements and thermodynamic functions of crystalline α-D-glucose at temperatures from 10K to 340K | journal = J. Chem. Thermodynam. | year = 1991 | volume = 23 | issue = 5 | pages = 403–9 | doi = 10.1016/S0021-9614(05)80128-4}}.</ref>
| DeltaHf = −1271 kJ/mol
| DeltaHc = −2805 kJ/mol
| Entropy = 209.2 J K<sup>−1</sup> mol<sup>−1</sup>
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS = [http://www.inchem.org/documents/icsc/icsc/eics0865.htm ICSC 0865]
| EUIndex = nije listiran
}}
}}
▲'''Glukoza''' ({{jez-|Glc}}) je najrasprostranjeniji [[monosaharid]] u [[priroda|prirodi]], međutim samo kao [[izomer]] koji se zove dekstroza ili grožđani šećer.<ref>{{citation | contribution = dextrose | url = http://www.m-w.com/dictionary/dextrose | title = Merriam-Webster Online Dictionary | accessdate = 2. 9. 2009.}}.</ref> Može da se nađe u [[krv]]i svih [[sisari|sisara]] kao i u [[med]]u i [[grožđe|grožđu]].
Molekuli složenijih ugljenih hidrata kao što su [[skrob]] i [[celuloza]] nastaju od velikog broja molekula glukoze.<ref name="Ullmann">{{cite book | author=Ullmann Fred W. Schenck | title=Glucose and Glucose-Containing Syrups in Ullmann's Encyclopedia of Industrial Chemistry | edition= | issue= | pages= | publisher=Wiley-VCH, Weinheim | year=2006 | isbn= | doi=10.1002/14356007.a12_457.pub2 | url= }}</ref>
Glukoza ima vrlo sladak ukus, lako je [[rastvorljivost|rastvorljiva]] u [[voda|vodi]], a takođe je i neophodna za održavanje [[život]]a jer kad se razgradi u [[citoplazma|citoplazmi]] žive [[ćelije]] oslobađa velike količine [[energija|energije]] potrebne za mnoge životne funkcije.
==
Reagens za dokazivanje glukoze zove se [[Tromerov reagens]]. To je
== Izvori ==
{{reflist|2}}
== Spoljašnje veze==
{{Commonscat|Glucose}}
{{-}}
{{ugljeni hidrati}}
{{Glikogenezni i glikogenolizni metabolički međuprodukti}}
{{Commonscat|Glucose}}
| |||